C32H36NO2+ — CID 21450367
2,2-dimethyl-4-[1-(naphthalen-2-ylmethyl)pyridin-1-ium-4-yl]-7-pentyl-3,4-dihydrochromen-5-ol (PubChem CID 21450367) has the molecular formula C32H36NO2+ and a molecular weight of 466.65 g/mol. Its IUPAC name is 2,2-dimethyl-4-[1-(naphthalen-2-ylmethyl)pyridin-1-ium-4-yl]-7-pentyl-3,4-dihydrochromen-5-ol.
| Compound Name | 2,2-dimethyl-4-[1-(naphthalen-2-ylmethyl)pyridin-1-ium-4-yl]-7-pentyl-3,4-dihydrochromen-5-ol |
|---|---|
| PubChem CID | 21450367 |
| Molecular Formula | C32H36NO2+ |
| Molecular Weight | 466.65 g/mol |
| Exact Mass | 466.27 |
| IUPAC Name | 2,2-dimethyl-4-[1-(naphthalen-2-ylmethyl)pyridin-1-ium-4-yl]-7-pentyl-3,4-dihydrochromen-5-ol |
| SMILES | CCCCCc1cc(O)c2c(c1)OC(C)(C)CC2c1cc[n+](Cc2ccc3ccccc3c2)cc1 |
| InChI | InChI=1S/C32H35NO2/c1-4-5-6-9-23-19-29(34)31-28(21-32(2,3)35-30(31)20-23)26-14-16-33(17-15-26)22-24-12-13-25-10-7-8-11-27(25)18-24/h7-8,10-20,28H,4-6,9,21-22H2,1-3H3/p+1 |
| InChIKey | GFPQEFGCKKBYIO-UHFFFAOYSA-O |
| XLogP | 7.31 |
| TPSA | 33.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.65 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|