C18H23ClN2O2 — CID 21451077
2,3-diamino-4-hydroxy-1,4-diphenylhexan-1-one;hydrochloride (PubChem CID 21451077) has the molecular formula C18H23ClN2O2 and a molecular weight of 334.85 g/mol. Its IUPAC name is 2,3-diamino-4-hydroxy-1,4-diphenylhexan-1-one;hydrochloride.
| Compound Name | 2,3-diamino-4-hydroxy-1,4-diphenylhexan-1-one;hydrochloride |
|---|---|
| PubChem CID | 21451077 |
| Molecular Formula | C18H23ClN2O2 |
| Molecular Weight | 334.85 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | 2,3-diamino-4-hydroxy-1,4-diphenylhexan-1-one;hydrochloride |
| SMILES | CCC(O)(c1ccccc1)C(N)C(N)C(=O)c1ccccc1.Cl |
| InChI | InChI=1S/C18H22N2O2.ClH/c1-2-18(22,14-11-7-4-8-12-14)17(20)15(19)16(21)13-9-5-3-6-10-13;/h3-12,15,17,22H,2,19-20H2,1H3;1H |
| InChIKey | SPZUXXZDZWMXMF-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 89.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.85 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |