C10H14N2O2Pt — CID 174439836
2,4-diamino-3-hydroxy-1-phenylbutan-1-one;platinum (PubChem CID 174439836) has the molecular formula C10H14N2O2Pt and a molecular weight of 389.31 g/mol. Its IUPAC name is 2,4-diamino-3-hydroxy-1-phenylbutan-1-one;platinum.
| Compound Name | 2,4-diamino-3-hydroxy-1-phenylbutan-1-one;platinum |
|---|---|
| PubChem CID | 174439836 |
| Molecular Formula | C10H14N2O2Pt |
| Molecular Weight | 389.31 g/mol |
| Exact Mass | 389.07 |
| IUPAC Name | 2,4-diamino-3-hydroxy-1-phenylbutan-1-one;platinum |
| SMILES | NCC(O)C(N)C(=O)c1ccccc1.[Pt] |
| InChI | InChI=1S/C10H14N2O2.Pt/c11-6-8(13)9(12)10(14)7-4-2-1-3-5-7;/h1-5,8-9,13H,6,11-12H2; |
| InChIKey | FKPRFNPCNNCWIV-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 89.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.31 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |