C23H23NO2 — CID 173171749
(2S,3R)-2-amino-1-(4-benzhydrylphenyl)-3-hydroxybutan-1-one (PubChem CID 173171749) has the molecular formula C23H23NO2 and a molecular weight of 345.44 g/mol. Its IUPAC name is (2S,3R)-2-amino-1-(4-benzhydrylphenyl)-3-hydroxybutan-1-one.
| Compound Name | (2S,3R)-2-amino-1-(4-benzhydrylphenyl)-3-hydroxybutan-1-one |
|---|---|
| PubChem CID | 173171749 |
| Molecular Formula | C23H23NO2 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | (2S,3R)-2-amino-1-(4-benzhydrylphenyl)-3-hydroxybutan-1-one |
| SMILES | C[C@@H](O)[C@H](N)C(=O)c1ccc(C(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H23NO2/c1-16(25)22(24)23(26)20-14-12-19(13-15-20)21(17-8-4-2-5-9-17)18-10-6-3-7-11-18/h2-16,21-22,25H,24H2,1H3/t16-,22+/m1/s1 |
| InChIKey | UNPRYIMNORDLIR-ZHRRBRCNSA-N |
| XLogP | 3.76 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|