C10H13NO3 — CID 99867992
(2S,3R)-2-amino-3,4-dihydroxy-1-phenylbutan-1-one (PubChem CID 99867992) has the molecular formula C10H13NO3 and a molecular weight of 195.22 g/mol. Its IUPAC name is (2S,3R)-2-amino-3,4-dihydroxy-1-phenylbutan-1-one.
| Compound Name | (2S,3R)-2-amino-3,4-dihydroxy-1-phenylbutan-1-one |
|---|---|
| PubChem CID | 99867992 |
| Molecular Formula | C10H13NO3 |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.09 |
| IUPAC Name | (2S,3R)-2-amino-3,4-dihydroxy-1-phenylbutan-1-one |
| SMILES | N[C@H](C(=O)c1ccccc1)[C@@H](O)CO |
| InChI | InChI=1S/C10H13NO3/c11-9(8(13)6-12)10(14)7-4-2-1-3-5-7/h1-5,8-9,12-13H,6,11H2/t8-,9-/m0/s1 |
| InChIKey | MCXXBDYRDCUDFI-IUCAKERBSA-N |
| XLogP | -0.45 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |