C18H25N3O2 — CID 21451599
4-[2-[3-(dimethylamino)butan-2-yloxy]phenoxy]benzene-1,2-diamine (PubChem CID 21451599) has the molecular formula C18H25N3O2 and a molecular weight of 315.42 g/mol. Its IUPAC name is 4-[2-[3-(dimethylamino)butan-2-yloxy]phenoxy]benzene-1,2-diamine.
| Compound Name | 4-[2-[3-(dimethylamino)butan-2-yloxy]phenoxy]benzene-1,2-diamine |
|---|---|
| PubChem CID | 21451599 |
| Molecular Formula | C18H25N3O2 |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.19 |
| IUPAC Name | 4-[2-[3-(dimethylamino)butan-2-yloxy]phenoxy]benzene-1,2-diamine |
| SMILES | CC(Oc1ccccc1Oc1ccc(N)c(N)c1)C(C)N(C)C |
| InChI | InChI=1S/C18H25N3O2/c1-12(21(3)4)13(2)22-17-7-5-6-8-18(17)23-14-9-10-15(19)16(20)11-14/h5-13H,19-20H2,1-4H3 |
| InChIKey | OGOVXMQXNRCWIJ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 73.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|