C20H24NO5PS — CID 21454421
4-[4-[butan-2-ylsulfanyl(ethoxy)phosphoryl]oxybenzoyl]benzamide (PubChem CID 21454421) has the molecular formula C20H24NO5PS and a molecular weight of 421.46 g/mol. Its IUPAC name is 4-[4-[butan-2-ylsulfanyl(ethoxy)phosphoryl]oxybenzoyl]benzamide.
| Compound Name | 4-[4-[butan-2-ylsulfanyl(ethoxy)phosphoryl]oxybenzoyl]benzamide |
|---|---|
| PubChem CID | 21454421 |
| Molecular Formula | C20H24NO5PS |
| Molecular Weight | 421.46 g/mol |
| Exact Mass | 421.11 |
| IUPAC Name | 4-[4-[butan-2-ylsulfanyl(ethoxy)phosphoryl]oxybenzoyl]benzamide |
| SMILES | CCOP(=O)(Oc1ccc(C(=O)c2ccc(C(N)=O)cc2)cc1)SC(C)CC |
| InChI | InChI=1S/C20H24NO5PS/c1-4-14(3)28-27(24,25-5-2)26-18-12-10-16(11-13-18)19(22)15-6-8-17(9-7-15)20(21)23/h6-14H,4-5H2,1-3H3,(H2,21,23) |
| InChIKey | OTXAPFPNAGKMIR-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.46 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|