C15H23N2O4PS — CID 70591889
[4-[[butan-2-ylsulfanyl(methylamino)phosphoryl]-methylcarbamoyl]phenyl] acetate (PubChem CID 70591889) has the molecular formula C15H23N2O4PS and a molecular weight of 358.40 g/mol. Its IUPAC name is [4-[[butan-2-ylsulfanyl(methylamino)phosphoryl]-methylcarbamoyl]phenyl] acetate.
| Compound Name | [4-[[butan-2-ylsulfanyl(methylamino)phosphoryl]-methylcarbamoyl]phenyl] acetate |
|---|---|
| PubChem CID | 70591889 |
| Molecular Formula | C15H23N2O4PS |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | [4-[[butan-2-ylsulfanyl(methylamino)phosphoryl]-methylcarbamoyl]phenyl] acetate |
| SMILES | CCC(C)SP(=O)(NC)N(C)C(=O)c1ccc(OC(C)=O)cc1 |
| InChI | InChI=1S/C15H23N2O4PS/c1-6-11(2)23-22(20,16-4)17(5)15(19)13-7-9-14(10-8-13)21-12(3)18/h7-11H,6H2,1-5H3,(H,16,20) |
| InChIKey | RRXFOEAFSCODKR-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|