About [4-[[butan-2-ylsulfanyl(methylamino)phosphoryl]-methylcarbamoyl]phenyl] hept-2-enoate
[4-[[butan-2-ylsulfanyl(methylamino)phosphoryl]-methylcarbamoyl]phenyl] hept-2-enoate (PubChem CID 70593169) has the molecular formula C20H31N2O4PS
and a molecular weight of 426.52 g/mol. Its IUPAC name is [4-[[butan-2-ylsulfanyl(methylamino)phosphoryl]-methylcarbamoyl]phenyl] hept-2-enoate.
Molecular Properties
| Compound Name | [4-[[butan-2-ylsulfanyl(methylamino)phosphoryl]-methylcarbamoyl]phenyl] hept-2-enoate |
| PubChem CID | 70593169 |
| Molecular Formula | C20H31N2O4PS |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | [4-[[butan-2-ylsulfanyl(methylamino)phosphoryl]-methylcarbamoyl]phenyl] hept-2-enoate |
| SMILES | CCCCC=CC(=O)Oc1ccc(C(=O)N(C)P(=O)(NC)SC(C)CC)cc1 |
| InChI | InChI=1S/C20H31N2O4PS/c1-6-8-9-10-11-19(23)26-18-14-12-17(13-15-18)20(24)22(5)27(25,21-4)28-16(3)7-2/h10-16H,6-9H2,1-5H3,(H,21,25) |
| InChIKey | SRYQMJKJZMWBMM-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [4-[[butan-2-ylsulfanyl(methylamino)phosphoryl]-methylcarbamoyl]phenyl] hept-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[[butan-2-ylsulfanyl(methylamino)phosphoryl]-methylcarbamoyl]phenyl] hept-2-enoate?
The IUPAC name of [4-[[butan-2-ylsulfanyl(methylamino)phosphoryl]-methylcarbamoyl]phenyl] hept-2-enoate (CID 70593169) is [4-[[butan-2-ylsulfanyl(methylamino)phosphoryl]-methylcarbamoyl]phenyl] hept-2-enoate.
What is the SMILES notation for [4-[[butan-2-ylsulfanyl(methylamino)phosphoryl]-methylcarbamoyl]phenyl] hept-2-enoate?
The canonical SMILES for [4-[[butan-2-ylsulfanyl(methylamino)phosphoryl]-methylcarbamoyl]phenyl] hept-2-enoate is CCCCC=CC(=O)Oc1ccc(C(=O)N(C)P(=O)(NC)SC(C)CC)cc1.
What is the InChIKey of [4-[[butan-2-ylsulfanyl(methylamino)phosphoryl]-methylcarbamoyl]phenyl] hept-2-enoate?
The InChIKey is SRYQMJKJZMWBMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H31N2O4PS/c1-6-8-9-10-11-19(23)26-18-14-12-17(13-15-18)20(24)22(5)27(25,21-4)28-16(3)7-2/h10-16H,6-9H2,1-5H3,(H,21,25).
What are the key properties of [4-[[butan-2-ylsulfanyl(methylamino)phosphoryl]-methylcarbamoyl]phenyl] hept-2-enoate?
[4-[[butan-2-ylsulfanyl(methylamino)phosphoryl]-methylcarbamoyl]phenyl] hept-2-enoate has a molecular weight of 426.52 g/mol, XLogP of 5.27, 11 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[[butan-2-ylsulfanyl(methylamino)phosphoryl]-methylcarbamoyl]phenyl] hept-2-enoate is sourced from PubChem (CID 70593169), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).