C16H26N3O2PS — CID 57099973
N'-(4-acetylphenyl)-N-[butan-2-ylsulfanyl(methylamino)phosphoryl]-N-ethylmethanimidamide (PubChem CID 57099973) has the molecular formula C16H26N3O2PS and a molecular weight of 355.44 g/mol. Its IUPAC name is N'-(4-acetylphenyl)-N-[butan-2-ylsulfanyl(methylamino)phosphoryl]-N-ethylmethanimidamide.
| Compound Name | N'-(4-acetylphenyl)-N-[butan-2-ylsulfanyl(methylamino)phosphoryl]-N-ethylmethanimidamide |
|---|---|
| PubChem CID | 57099973 |
| Molecular Formula | C16H26N3O2PS |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | N'-(4-acetylphenyl)-N-[butan-2-ylsulfanyl(methylamino)phosphoryl]-N-ethylmethanimidamide |
| SMILES | CCC(C)SP(=O)(NC)N(/C=N/c1ccc(C(C)=O)cc1)CC |
| InChI | InChI=1S/C16H26N3O2PS/c1-6-13(3)23-22(21,17-5)19(7-2)12-18-16-10-8-15(9-11-16)14(4)20/h8-13H,6-7H2,1-5H3,(H,17,21)/b18-12+ |
| InChIKey | KYOPSQNWVKNRNM-LDADJPATSA-N |
| XLogP | 4.73 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|