About 3,8-dihydrotriazolo[5,1-a]isoindol-2-amine
3,8-dihydrotriazolo[5,1-a]isoindol-2-amine (PubChem CID 21455319) has the molecular formula C9H10N4
and a molecular weight of 174.21 g/mol. Its IUPAC name is 3,8-dihydrotriazolo[5,1-a]isoindol-2-amine.
Molecular Properties
| Compound Name | 3,8-dihydrotriazolo[5,1-a]isoindol-2-amine |
| PubChem CID | 21455319 |
| Molecular Formula | C9H10N4 |
| Molecular Weight | 174.21 g/mol |
| Exact Mass | 174.09 |
| IUPAC Name | 3,8-dihydrotriazolo[5,1-a]isoindol-2-amine |
| SMILES | NN1C=c2c3c(cn2N1)C=CCC=3 |
| InChI | InChI=1S/C9H10N4/c10-13-6-9-8-4-2-1-3-7(8)5-12(9)11-13/h1,3-6,11H,2,10H2 |
| InChIKey | VAMSLXFNRMNECW-UHFFFAOYSA-N |
| XLogP | -0.93 |
| TPSA | 46.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.21 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|
Analyze 3,8-dihydrotriazolo[5,1-a]isoindol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,8-dihydrotriazolo[5,1-a]isoindol-2-amine?
The IUPAC name of 3,8-dihydrotriazolo[5,1-a]isoindol-2-amine (CID 21455319) is 3,8-dihydrotriazolo[5,1-a]isoindol-2-amine.
What is the SMILES notation for 3,8-dihydrotriazolo[5,1-a]isoindol-2-amine?
The canonical SMILES for 3,8-dihydrotriazolo[5,1-a]isoindol-2-amine is NN1C=c2c3c(cn2N1)C=CCC=3.
What is the InChIKey of 3,8-dihydrotriazolo[5,1-a]isoindol-2-amine?
The InChIKey is VAMSLXFNRMNECW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N4/c10-13-6-9-8-4-2-1-3-7(8)5-12(9)11-13/h1,3-6,11H,2,10H2.
What are the key properties of 3,8-dihydrotriazolo[5,1-a]isoindol-2-amine?
3,8-dihydrotriazolo[5,1-a]isoindol-2-amine has a molecular weight of 174.21 g/mol, XLogP of -0.93, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,8-dihydrotriazolo[5,1-a]isoindol-2-amine is sourced from PubChem (CID 21455319), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).