C18H14Cl2N2O3 — CID 21460720
4,6-dichloro-3-[methyl(phenacyl)amino]-1H-indole-2-carboxylic acid (PubChem CID 21460720) has the molecular formula C18H14Cl2N2O3 and a molecular weight of 377.23 g/mol. Its IUPAC name is 4,6-dichloro-3-[methyl(phenacyl)amino]-1H-indole-2-carboxylic acid.
| Compound Name | 4,6-dichloro-3-[methyl(phenacyl)amino]-1H-indole-2-carboxylic acid |
|---|---|
| PubChem CID | 21460720 |
| Molecular Formula | C18H14Cl2N2O3 |
| Molecular Weight | 377.23 g/mol |
| Exact Mass | 376.04 |
| IUPAC Name | 4,6-dichloro-3-[methyl(phenacyl)amino]-1H-indole-2-carboxylic acid |
| SMILES | CN(CC(=O)c1ccccc1)c1c(C(=O)O)[nH]c2cc(Cl)cc(Cl)c12 |
| InChI | InChI=1S/C18H14Cl2N2O3/c1-22(9-14(23)10-5-3-2-4-6-10)17-15-12(20)7-11(19)8-13(15)21-16(17)18(24)25/h2-8,21H,9H2,1H3,(H,24,25) |
| InChIKey | PSNUAYGGOXACAR-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 73.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.23 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |