About CID 21462142
CID 21462142 (PubChem CID 21462142) has the molecular formula C20H28Si2
and a molecular weight of 324.62 g/mol.
Molecular Properties
| Compound Name | CID 21462142 |
| PubChem CID | 21462142 |
| Molecular Formula | C20H28Si2 |
| Molecular Weight | 324.62 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | — |
| SMILES | Cc1ccc(CC[Si](C)[Si](C)CCc2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C20H28Si2/c1-17-5-9-19(10-6-17)13-15-21(3)22(4)16-14-20-11-7-18(2)8-12-20/h5-12H,13-16H2,1-4H3 |
| InChIKey | ZWYFPPOKLIEJGO-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 324.62 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 21462142 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 21462142?
The IUPAC name of CID 21462142 (CID 21462142) is not available.
What is the SMILES notation for CID 21462142?
The canonical SMILES for CID 21462142 is Cc1ccc(CC[Si](C)[Si](C)CCc2ccc(C)cc2)cc1.
What is the InChIKey of CID 21462142?
The InChIKey is ZWYFPPOKLIEJGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H28Si2/c1-17-5-9-19(10-6-17)13-15-21(3)22(4)16-14-20-11-7-18(2)8-12-20/h5-12H,13-16H2,1-4H3.
What are the key properties of CID 21462142?
CID 21462142 has a molecular weight of 324.62 g/mol, XLogP of 5.42, 7 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 21462142 is sourced from PubChem (CID 21462142), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).