C27H26N2O2 — CID 21463261
2,6,7-trimethyl-1-oxo-4-phenyl-N-(2-phenylethyl)isoquinoline-3-carboxamide (PubChem CID 21463261) has the molecular formula C27H26N2O2 and a molecular weight of 410.52 g/mol. Its IUPAC name is 2,6,7-trimethyl-1-oxo-4-phenyl-N-(2-phenylethyl)isoquinoline-3-carboxamide.
| Compound Name | 2,6,7-trimethyl-1-oxo-4-phenyl-N-(2-phenylethyl)isoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 21463261 |
| Molecular Formula | C27H26N2O2 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.20 |
| IUPAC Name | 2,6,7-trimethyl-1-oxo-4-phenyl-N-(2-phenylethyl)isoquinoline-3-carboxamide |
| SMILES | Cc1cc2c(-c3ccccc3)c(C(=O)NCCc3ccccc3)n(C)c(=O)c2cc1C |
| InChI | InChI=1S/C27H26N2O2/c1-18-16-22-23(17-19(18)2)27(31)29(3)25(24(22)21-12-8-5-9-13-21)26(30)28-15-14-20-10-6-4-7-11-20/h4-13,16-17H,14-15H2,1-3H3,(H,28,30) |
| InChIKey | JLYJNRRCTYITDS-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |