C26H22N2O4 — CID 23859972
[2-(benzylamino)-2-oxoethyl] 2-methyl-1-oxo-4-phenylisoquinoline-3-carboxylate (PubChem CID 23859972) has the molecular formula C26H22N2O4 and a molecular weight of 426.47 g/mol. Its IUPAC name is [2-(benzylamino)-2-oxoethyl] 2-methyl-1-oxo-4-phenylisoquinoline-3-carboxylate.
| Compound Name | [2-(benzylamino)-2-oxoethyl] 2-methyl-1-oxo-4-phenylisoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 23859972 |
| Molecular Formula | C26H22N2O4 |
| Molecular Weight | 426.47 g/mol |
| Exact Mass | 426.16 |
| IUPAC Name | [2-(benzylamino)-2-oxoethyl] 2-methyl-1-oxo-4-phenylisoquinoline-3-carboxylate |
| SMILES | Cn1c(C(=O)OCC(=O)NCc2ccccc2)c(-c2ccccc2)c2ccccc2c1=O |
| InChI | InChI=1S/C26H22N2O4/c1-28-24(26(31)32-17-22(29)27-16-18-10-4-2-5-11-18)23(19-12-6-3-7-13-19)20-14-8-9-15-21(20)25(28)30/h2-15H,16-17H2,1H3,(H,27,29) |
| InChIKey | LKVYWVJUSURYNH-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.47 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |