C25H19IN2O4 — CID 23971557
[2-(4-iodoanilino)-2-oxoethyl] 2-methyl-1-oxo-4-phenylisoquinoline-3-carboxylate (PubChem CID 23971557) has the molecular formula C25H19IN2O4 and a molecular weight of 538.34 g/mol. Its IUPAC name is [2-(4-iodoanilino)-2-oxoethyl] 2-methyl-1-oxo-4-phenylisoquinoline-3-carboxylate.
| Compound Name | [2-(4-iodoanilino)-2-oxoethyl] 2-methyl-1-oxo-4-phenylisoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 23971557 |
| Molecular Formula | C25H19IN2O4 |
| Molecular Weight | 538.34 g/mol |
| Exact Mass | 538.04 |
| IUPAC Name | [2-(4-iodoanilino)-2-oxoethyl] 2-methyl-1-oxo-4-phenylisoquinoline-3-carboxylate |
| SMILES | Cn1c(C(=O)OCC(=O)Nc2ccc(I)cc2)c(-c2ccccc2)c2ccccc2c1=O |
| InChI | InChI=1S/C25H19IN2O4/c1-28-23(25(31)32-15-21(29)27-18-13-11-17(26)12-14-18)22(16-7-3-2-4-8-16)19-9-5-6-10-20(19)24(28)30/h2-14H,15H2,1H3,(H,27,29) |
| InChIKey | AKJANCMUMSHZAC-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.34 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|