C29H21NO4 — CID 23744608
(2-naphthalen-2-yl-2-oxoethyl) 2-methyl-1-oxo-4-phenylisoquinoline-3-carboxylate (PubChem CID 23744608) has the molecular formula C29H21NO4 and a molecular weight of 447.49 g/mol. Its IUPAC name is (2-naphthalen-2-yl-2-oxoethyl) 2-methyl-1-oxo-4-phenylisoquinoline-3-carboxylate.
| Compound Name | (2-naphthalen-2-yl-2-oxoethyl) 2-methyl-1-oxo-4-phenylisoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 23744608 |
| Molecular Formula | C29H21NO4 |
| Molecular Weight | 447.49 g/mol |
| Exact Mass | 447.15 |
| IUPAC Name | (2-naphthalen-2-yl-2-oxoethyl) 2-methyl-1-oxo-4-phenylisoquinoline-3-carboxylate |
| SMILES | Cn1c(C(=O)OCC(=O)c2ccc3ccccc3c2)c(-c2ccccc2)c2ccccc2c1=O |
| InChI | InChI=1S/C29H21NO4/c1-30-27(26(20-10-3-2-4-11-20)23-13-7-8-14-24(23)28(30)32)29(33)34-18-25(31)22-16-15-19-9-5-6-12-21(19)17-22/h2-17H,18H2,1H3 |
| InChIKey | OEBDIIQICVRZLQ-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 65.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.49 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |