C31H24N2O5 — CID 23802633
[2-oxo-2-(4-phenoxyanilino)ethyl] 2-methyl-1-oxo-4-phenylisoquinoline-3-carboxylate (PubChem CID 23802633) has the molecular formula C31H24N2O5 and a molecular weight of 504.54 g/mol. Its IUPAC name is [2-oxo-2-(4-phenoxyanilino)ethyl] 2-methyl-1-oxo-4-phenylisoquinoline-3-carboxylate.
| Compound Name | [2-oxo-2-(4-phenoxyanilino)ethyl] 2-methyl-1-oxo-4-phenylisoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 23802633 |
| Molecular Formula | C31H24N2O5 |
| Molecular Weight | 504.54 g/mol |
| Exact Mass | 504.17 |
| IUPAC Name | [2-oxo-2-(4-phenoxyanilino)ethyl] 2-methyl-1-oxo-4-phenylisoquinoline-3-carboxylate |
| SMILES | Cn1c(C(=O)OCC(=O)Nc2ccc(Oc3ccccc3)cc2)c(-c2ccccc2)c2ccccc2c1=O |
| InChI | InChI=1S/C31H24N2O5/c1-33-29(28(21-10-4-2-5-11-21)25-14-8-9-15-26(25)30(33)35)31(36)37-20-27(34)32-22-16-18-24(19-17-22)38-23-12-6-3-7-13-23/h2-19H,20H2,1H3,(H,32,34) |
| InChIKey | SIXZYYQUZOJOJR-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.54 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |