About methanethioyloxymethyl 2-[4-(hydroxymethyl)phenyl]benzoate
methanethioyloxymethyl 2-[4-(hydroxymethyl)phenyl]benzoate (PubChem CID 21464234) has the molecular formula C16H14O4S
and a molecular weight of 302.35 g/mol. Its IUPAC name is methanethioyloxymethyl 2-[4-(hydroxymethyl)phenyl]benzoate.
Molecular Properties
| Compound Name | methanethioyloxymethyl 2-[4-(hydroxymethyl)phenyl]benzoate |
| PubChem CID | 21464234 |
| Molecular Formula | C16H14O4S |
| Molecular Weight | 302.35 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | methanethioyloxymethyl 2-[4-(hydroxymethyl)phenyl]benzoate |
| SMILES | O=C(OCOC=S)c1ccccc1-c1ccc(CO)cc1 |
| InChI | InChI=1S/C16H14O4S/c17-9-12-5-7-13(8-6-12)14-3-1-2-4-15(14)16(18)20-10-19-11-21/h1-8,11,17H,9-10H2 |
| InChIKey | YSWFOMOPXRGKFZ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.35 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze methanethioyloxymethyl 2-[4-(hydroxymethyl)phenyl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanethioyloxymethyl 2-[4-(hydroxymethyl)phenyl]benzoate?
The IUPAC name of methanethioyloxymethyl 2-[4-(hydroxymethyl)phenyl]benzoate (CID 21464234) is methanethioyloxymethyl 2-[4-(hydroxymethyl)phenyl]benzoate.
What is the SMILES notation for methanethioyloxymethyl 2-[4-(hydroxymethyl)phenyl]benzoate?
The canonical SMILES for methanethioyloxymethyl 2-[4-(hydroxymethyl)phenyl]benzoate is O=C(OCOC=S)c1ccccc1-c1ccc(CO)cc1.
What is the InChIKey of methanethioyloxymethyl 2-[4-(hydroxymethyl)phenyl]benzoate?
The InChIKey is YSWFOMOPXRGKFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14O4S/c17-9-12-5-7-13(8-6-12)14-3-1-2-4-15(14)16(18)20-10-19-11-21/h1-8,11,17H,9-10H2.
What are the key properties of methanethioyloxymethyl 2-[4-(hydroxymethyl)phenyl]benzoate?
methanethioyloxymethyl 2-[4-(hydroxymethyl)phenyl]benzoate has a molecular weight of 302.35 g/mol, XLogP of 2.93, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methanethioyloxymethyl 2-[4-(hydroxymethyl)phenyl]benzoate is sourced from PubChem (CID 21464234), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).