C19H11ClF4N2O2S — CID 21467541
6-chloro-7-fluoro-1-(4-methylsulfonylphenyl)-3-(trifluoromethyl)benzo[g]indazole (PubChem CID 21467541) has the molecular formula C19H11ClF4N2O2S and a molecular weight of 442.82 g/mol. Its IUPAC name is 6-chloro-7-fluoro-1-(4-methylsulfonylphenyl)-3-(trifluoromethyl)benzo[g]indazole.
| Compound Name | 6-chloro-7-fluoro-1-(4-methylsulfonylphenyl)-3-(trifluoromethyl)benzo[g]indazole |
|---|---|
| PubChem CID | 21467541 |
| Molecular Formula | C19H11ClF4N2O2S |
| Molecular Weight | 442.82 g/mol |
| Exact Mass | 442.02 |
| IUPAC Name | 6-chloro-7-fluoro-1-(4-methylsulfonylphenyl)-3-(trifluoromethyl)benzo[g]indazole |
| SMILES | CS(=O)(=O)c1ccc(-n2nc(C(F)(F)F)c3ccc4c(Cl)c(F)ccc4c32)cc1 |
| InChI | InChI=1S/C19H11ClF4N2O2S/c1-29(27,28)11-4-2-10(3-5-11)26-17-13-8-9-15(21)16(20)12(13)6-7-14(17)18(25-26)19(22,23)24/h2-9H,1H3 |
| InChIKey | PZOCXRNHRDWVIS-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.82 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |