C15H16N4O3S2 — CID 21467691
N-(diaminomethylidene)-2-methyl-5-methylsulfonyl-4-pyridin-2-ylsulfanylbenzamide (PubChem CID 21467691) has the molecular formula C15H16N4O3S2 and a molecular weight of 364.45 g/mol. Its IUPAC name is N-(diaminomethylidene)-2-methyl-5-methylsulfonyl-4-pyridin-2-ylsulfanylbenzamide.
| Compound Name | N-(diaminomethylidene)-2-methyl-5-methylsulfonyl-4-pyridin-2-ylsulfanylbenzamide |
|---|---|
| PubChem CID | 21467691 |
| Molecular Formula | C15H16N4O3S2 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.07 |
| IUPAC Name | N-(diaminomethylidene)-2-methyl-5-methylsulfonyl-4-pyridin-2-ylsulfanylbenzamide |
| SMILES | Cc1cc(Sc2ccccn2)c(S(C)(=O)=O)cc1C(=O)N=C(N)N |
| InChI | InChI=1S/C15H16N4O3S2/c1-9-7-11(23-13-5-3-4-6-18-13)12(24(2,21)22)8-10(9)14(20)19-15(16)17/h3-8H,1-2H3,(H4,16,17,19,20) |
| InChIKey | SFPXFFVPTNRAQF-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 128.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|