C20H23N3O3S — CID 21469300
5-[[7-(2-piperidin-1-ylethoxy)quinolin-3-yl]methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 21469300) has the molecular formula C20H23N3O3S and a molecular weight of 385.49 g/mol. Its IUPAC name is 5-[[7-(2-piperidin-1-ylethoxy)quinolin-3-yl]methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[7-(2-piperidin-1-ylethoxy)quinolin-3-yl]methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 21469300 |
| Molecular Formula | C20H23N3O3S |
| Molecular Weight | 385.49 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | 5-[[7-(2-piperidin-1-ylethoxy)quinolin-3-yl]methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)C(Cc2cnc3cc(OCCN4CCCCC4)ccc3c2)S1 |
| InChI | InChI=1S/C20H23N3O3S/c24-19-18(27-20(25)22-19)11-14-10-15-4-5-16(12-17(15)21-13-14)26-9-8-23-6-2-1-3-7-23/h4-5,10,12-13,18H,1-3,6-9,11H2,(H,22,24,25) |
| InChIKey | XDKRIGOGJVUWSK-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.49 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|