C21H25BrN4O3S — CID 21481866
[3-(5-cyclopentyl-1,3,4-thiadiazol-2-yl)-1-methyl-2-oxo-1,3-diazinan-4-yl] 4-(1-bromoethyl)benzoate (PubChem CID 21481866) has the molecular formula C21H25BrN4O3S and a molecular weight of 493.43 g/mol. Its IUPAC name is [3-(5-cyclopentyl-1,3,4-thiadiazol-2-yl)-1-methyl-2-oxo-1,3-diazinan-4-yl] 4-(1-bromoethyl)benzoate.
| Compound Name | [3-(5-cyclopentyl-1,3,4-thiadiazol-2-yl)-1-methyl-2-oxo-1,3-diazinan-4-yl] 4-(1-bromoethyl)benzoate |
|---|---|
| PubChem CID | 21481866 |
| Molecular Formula | C21H25BrN4O3S |
| Molecular Weight | 493.43 g/mol |
| Exact Mass | 492.08 |
| IUPAC Name | [3-(5-cyclopentyl-1,3,4-thiadiazol-2-yl)-1-methyl-2-oxo-1,3-diazinan-4-yl] 4-(1-bromoethyl)benzoate |
| SMILES | CC(Br)c1ccc(C(=O)OC2CCN(C)C(=O)N2c2nnc(C3CCCC3)s2)cc1 |
| InChI | InChI=1S/C21H25BrN4O3S/c1-13(22)14-7-9-16(10-8-14)19(27)29-17-11-12-25(2)21(28)26(17)20-24-23-18(30-20)15-5-3-4-6-15/h7-10,13,15,17H,3-6,11-12H2,1-2H3 |
| InChIKey | LVAPOZDARNOUIE-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 75.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.43 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|