C19H21ClN2 — CID 21483782
2-[(5-chloro-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenylidene)amino]-N,N-dimethylethanamine (PubChem CID 21483782) has the molecular formula C19H21ClN2 and a molecular weight of 312.84 g/mol. Its IUPAC name is 2-[(5-chloro-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenylidene)amino]-N,N-dimethylethanamine.
| Compound Name | 2-[(5-chloro-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenylidene)amino]-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 21483782 |
| Molecular Formula | C19H21ClN2 |
| Molecular Weight | 312.84 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | 2-[(5-chloro-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenylidene)amino]-N,N-dimethylethanamine |
| SMILES | CN(C)CC/N=C1\c2ccccc2CCc2ccc(Cl)cc21 |
| InChI | InChI=1S/C19H21ClN2/c1-22(2)12-11-21-19-17-6-4-3-5-14(17)7-8-15-9-10-16(20)13-18(15)19/h3-6,9-10,13H,7-8,11-12H2,1-2H3/b21-19+ |
| InChIKey | BGCQURJQCRIOFH-XUTLUUPISA-N |
| XLogP | 3.84 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.84 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|