About 2-(6H-benzo[c][1]benzothiepin-11-ylideneamino)-N,N-dimethylethanamine
2-(6H-benzo[c][1]benzothiepin-11-ylideneamino)-N,N-dimethylethanamine (PubChem CID 21483796) has the molecular formula C18H20N2S
and a molecular weight of 296.44 g/mol. Its IUPAC name is 2-(6H-benzo[c][1]benzothiepin-11-ylideneamino)-N,N-dimethylethanamine.
Molecular Properties
| Compound Name | 2-(6H-benzo[c][1]benzothiepin-11-ylideneamino)-N,N-dimethylethanamine |
| PubChem CID | 21483796 |
| Molecular Formula | C18H20N2S |
| Molecular Weight | 296.44 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | 2-(6H-benzo[c][1]benzothiepin-11-ylideneamino)-N,N-dimethylethanamine |
| SMILES | CN(C)CC/N=C1\c2ccccc2CSc2ccccc21 |
| InChI | InChI=1S/C18H20N2S/c1-20(2)12-11-19-18-15-8-4-3-7-14(15)13-21-17-10-6-5-9-16(17)18/h3-10H,11-13H2,1-2H3/b19-18+ |
| InChIKey | OPLXRHDMCYJUQH-VHEBQXMUSA-N |
| XLogP | 3.69 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.44 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(6H-benzo[c][1]benzothiepin-11-ylideneamino)-N,N-dimethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6H-benzo[c][1]benzothiepin-11-ylideneamino)-N,N-dimethylethanamine?
The IUPAC name of 2-(6H-benzo[c][1]benzothiepin-11-ylideneamino)-N,N-dimethylethanamine (CID 21483796) is 2-(6H-benzo[c][1]benzothiepin-11-ylideneamino)-N,N-dimethylethanamine.
What is the SMILES notation for 2-(6H-benzo[c][1]benzothiepin-11-ylideneamino)-N,N-dimethylethanamine?
The canonical SMILES for 2-(6H-benzo[c][1]benzothiepin-11-ylideneamino)-N,N-dimethylethanamine is CN(C)CC/N=C1\c2ccccc2CSc2ccccc21.
What is the InChIKey of 2-(6H-benzo[c][1]benzothiepin-11-ylideneamino)-N,N-dimethylethanamine?
The InChIKey is OPLXRHDMCYJUQH-VHEBQXMUSA-N. The full InChI is InChI=1S/C18H20N2S/c1-20(2)12-11-19-18-15-8-4-3-7-14(15)13-21-17-10-6-5-9-16(17)18/h3-10H,11-13H2,1-2H3/b19-18+.
What are the key properties of 2-(6H-benzo[c][1]benzothiepin-11-ylideneamino)-N,N-dimethylethanamine?
2-(6H-benzo[c][1]benzothiepin-11-ylideneamino)-N,N-dimethylethanamine has a molecular weight of 296.44 g/mol, XLogP of 3.69, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6H-benzo[c][1]benzothiepin-11-ylideneamino)-N,N-dimethylethanamine is sourced from PubChem (CID 21483796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).