C16H23NO2S — CID 21491940
2,5-di(butan-2-yl)-4-methylsulfonylbenzonitrile (PubChem CID 21491940) has the molecular formula C16H23NO2S and a molecular weight of 293.43 g/mol. Its IUPAC name is 2,5-di(butan-2-yl)-4-methylsulfonylbenzonitrile.
| Compound Name | 2,5-di(butan-2-yl)-4-methylsulfonylbenzonitrile |
|---|---|
| PubChem CID | 21491940 |
| Molecular Formula | C16H23NO2S |
| Molecular Weight | 293.43 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | 2,5-di(butan-2-yl)-4-methylsulfonylbenzonitrile |
| SMILES | CCC(C)c1cc(S(C)(=O)=O)c(C(C)CC)cc1C#N |
| InChI | InChI=1S/C16H23NO2S/c1-6-11(3)14-9-16(20(5,18)19)15(12(4)7-2)8-13(14)10-17/h8-9,11-12H,6-7H2,1-5H3 |
| InChIKey | RKVKBRYWUNYHQY-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 57.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.43 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |