C22H24N2O2S — CID 2150707
(1-tert-butyl-3-methyl-4-phenylsulfanylpyrazol-5-yl) 2-methylbenzoate (PubChem CID 2150707) has the molecular formula C22H24N2O2S and a molecular weight of 380.51 g/mol. Its IUPAC name is (1-tert-butyl-3-methyl-4-phenylsulfanylpyrazol-5-yl) 2-methylbenzoate.
| Compound Name | (1-tert-butyl-3-methyl-4-phenylsulfanylpyrazol-5-yl) 2-methylbenzoate |
|---|---|
| PubChem CID | 2150707 |
| Molecular Formula | C22H24N2O2S |
| Molecular Weight | 380.51 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | (1-tert-butyl-3-methyl-4-phenylsulfanylpyrazol-5-yl) 2-methylbenzoate |
| SMILES | Cc1ccccc1C(=O)Oc1c(Sc2ccccc2)c(C)nn1C(C)(C)C |
| InChI | InChI=1S/C22H24N2O2S/c1-15-11-9-10-14-18(15)21(25)26-20-19(27-17-12-7-6-8-13-17)16(2)23-24(20)22(3,4)5/h6-14H,1-5H3 |
| InChIKey | WUZHCGIPWVRUHO-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.51 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |