C14H20F4N2O4 — CID 2166372
2,2,3,3-tetrafluoro-N,N'-bis[[(2S)-oxolan-2-yl]methyl]butanediamide (PubChem CID 2166372) has the molecular formula C14H20F4N2O4 and a molecular weight of 356.32 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoro-N,N'-bis[[(2S)-oxolan-2-yl]methyl]butanediamide.
| Compound Name | 2,2,3,3-tetrafluoro-N,N'-bis[[(2S)-oxolan-2-yl]methyl]butanediamide |
|---|---|
| PubChem CID | 2166372 |
| Molecular Formula | C14H20F4N2O4 |
| Molecular Weight | 356.32 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | 2,2,3,3-tetrafluoro-N,N'-bis[[(2S)-oxolan-2-yl]methyl]butanediamide |
| SMILES | O=C(NC[C@@H]1CCCO1)C(F)(F)C(F)(F)C(=O)NC[C@@H]1CCCO1 |
| InChI | InChI=1S/C14H20F4N2O4/c15-13(16,11(21)19-7-9-3-1-5-23-9)14(17,18)12(22)20-8-10-4-2-6-24-10/h9-10H,1-8H2,(H,19,21)(H,20,22)/t9-,10-/m0/s1 |
| InChIKey | NLBADXVGXHHXRI-UWVGGRQHSA-N |
| XLogP | 0.85 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.32 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|