C23H25NO5 — CID 2167593
2-methoxyethyl (3R,4S)-2-methylidene-6-oxo-4-(2-phenylmethoxyphenyl)piperidine-3-carboxylate (PubChem CID 2167593) has the molecular formula C23H25NO5 and a molecular weight of 395.46 g/mol. Its IUPAC name is 2-methoxyethyl (3R,4S)-2-methylidene-6-oxo-4-(2-phenylmethoxyphenyl)piperidine-3-carboxylate.
| Compound Name | 2-methoxyethyl (3R,4S)-2-methylidene-6-oxo-4-(2-phenylmethoxyphenyl)piperidine-3-carboxylate |
|---|---|
| PubChem CID | 2167593 |
| Molecular Formula | C23H25NO5 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | 2-methoxyethyl (3R,4S)-2-methylidene-6-oxo-4-(2-phenylmethoxyphenyl)piperidine-3-carboxylate |
| SMILES | C=C1NC(=O)C[C@H](c2ccccc2OCc2ccccc2)[C@H]1C(=O)OCCOC |
| InChI | InChI=1S/C23H25NO5/c1-16-22(23(26)28-13-12-27-2)19(14-21(25)24-16)18-10-6-7-11-20(18)29-15-17-8-4-3-5-9-17/h3-11,19,22H,1,12-15H2,2H3,(H,24,25)/t19-,22+/m1/s1 |
| InChIKey | ZZPDGPAPSKVJBV-KNQAVFIVSA-N |
| XLogP | 3.19 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|