C13H8Cl2N2O3 — CID 2169348
[2-(2,4-dichlorophenyl)-2-oxoethyl] pyrazine-2-carboxylate (PubChem CID 2169348) has the molecular formula C13H8Cl2N2O3 and a molecular weight of 311.12 g/mol. Its IUPAC name is [2-(2,4-dichlorophenyl)-2-oxoethyl] pyrazine-2-carboxylate.
| Compound Name | [2-(2,4-dichlorophenyl)-2-oxoethyl] pyrazine-2-carboxylate |
|---|---|
| PubChem CID | 2169348 |
| Molecular Formula | C13H8Cl2N2O3 |
| Molecular Weight | 311.12 g/mol |
| Exact Mass | 309.99 |
| IUPAC Name | [2-(2,4-dichlorophenyl)-2-oxoethyl] pyrazine-2-carboxylate |
| SMILES | O=C(OCC(=O)c1ccc(Cl)cc1Cl)c1cnccn1 |
| InChI | InChI=1S/C13H8Cl2N2O3/c14-8-1-2-9(10(15)5-8)12(18)7-20-13(19)11-6-16-3-4-17-11/h1-6H,7H2 |
| InChIKey | TZNYTAFLMZPEQZ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 69.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.12 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |