C11H18N2O2 — CID 2169358
N,N'-bis(prop-2-enyl)pentanediamide (PubChem CID 2169358) has the molecular formula C11H18N2O2 and a molecular weight of 210.28 g/mol. Its IUPAC name is N,N'-bis(prop-2-enyl)pentanediamide.
| Compound Name | N,N'-bis(prop-2-enyl)pentanediamide |
|---|---|
| PubChem CID | 2169358 |
| Molecular Formula | C11H18N2O2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | N,N'-bis(prop-2-enyl)pentanediamide |
| SMILES | C=CCNC(=O)CCCC(=O)NCC=C |
| InChI | InChI=1S/C11H18N2O2/c1-3-8-12-10(14)6-5-7-11(15)13-9-4-2/h3-4H,1-2,5-9H2,(H,12,14)(H,13,15) |
| InChIKey | GPJYNGZPTDTXHY-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|