About 2-(2-bromo-4,6-dimethylphenoxy)ethyl-[(2R)-butan-2-yl]azanium
2-(2-bromo-4,6-dimethylphenoxy)ethyl-[(2R)-butan-2-yl]azanium (PubChem CID 2181294) has the molecular formula C14H23BrNO+
and a molecular weight of 301.25 g/mol. Its IUPAC name is 2-(2-bromo-4,6-dimethylphenoxy)ethyl-[(2R)-butan-2-yl]azanium.
Molecular Properties
| Compound Name | 2-(2-bromo-4,6-dimethylphenoxy)ethyl-[(2R)-butan-2-yl]azanium |
| PubChem CID | 2181294 |
| Molecular Formula | C14H23BrNO+ |
| Molecular Weight | 301.25 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | 2-(2-bromo-4,6-dimethylphenoxy)ethyl-[(2R)-butan-2-yl]azanium |
| SMILES | CC[C@@H](C)[NH2+]CCOc1c(C)cc(C)cc1Br |
| InChI | InChI=1S/C14H22BrNO/c1-5-12(4)16-6-7-17-14-11(3)8-10(2)9-13(14)15/h8-9,12,16H,5-7H2,1-4H3/p+1/t12-/m1/s1 |
| InChIKey | OEGPLRGIOAKCIY-GFCCVEGCSA-O |
| XLogP | 2.81 |
| TPSA | 25.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.25 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-bromo-4,6-dimethylphenoxy)ethyl-[(2R)-butan-2-yl]azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-bromo-4,6-dimethylphenoxy)ethyl-[(2R)-butan-2-yl]azanium?
The IUPAC name of 2-(2-bromo-4,6-dimethylphenoxy)ethyl-[(2R)-butan-2-yl]azanium (CID 2181294) is 2-(2-bromo-4,6-dimethylphenoxy)ethyl-[(2R)-butan-2-yl]azanium.
What is the SMILES notation for 2-(2-bromo-4,6-dimethylphenoxy)ethyl-[(2R)-butan-2-yl]azanium?
The canonical SMILES for 2-(2-bromo-4,6-dimethylphenoxy)ethyl-[(2R)-butan-2-yl]azanium is CC[C@@H](C)[NH2+]CCOc1c(C)cc(C)cc1Br.
What is the InChIKey of 2-(2-bromo-4,6-dimethylphenoxy)ethyl-[(2R)-butan-2-yl]azanium?
The InChIKey is OEGPLRGIOAKCIY-GFCCVEGCSA-O. The full InChI is InChI=1S/C14H22BrNO/c1-5-12(4)16-6-7-17-14-11(3)8-10(2)9-13(14)15/h8-9,12,16H,5-7H2,1-4H3/p+1/t12-/m1/s1.
What are the key properties of 2-(2-bromo-4,6-dimethylphenoxy)ethyl-[(2R)-butan-2-yl]azanium?
2-(2-bromo-4,6-dimethylphenoxy)ethyl-[(2R)-butan-2-yl]azanium has a molecular weight of 301.25 g/mol, XLogP of 2.81, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-bromo-4,6-dimethylphenoxy)ethyl-[(2R)-butan-2-yl]azanium is sourced from PubChem (CID 2181294), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).