C12H18BrNO2 — CID 39292056
2-[2-(2-bromo-4,6-dimethylphenoxy)ethylamino]ethanol (PubChem CID 39292056) has the molecular formula C12H18BrNO2 and a molecular weight of 288.19 g/mol. Its IUPAC name is 2-[2-(2-bromo-4,6-dimethylphenoxy)ethylamino]ethanol.
| Compound Name | 2-[2-(2-bromo-4,6-dimethylphenoxy)ethylamino]ethanol |
|---|---|
| PubChem CID | 39292056 |
| Molecular Formula | C12H18BrNO2 |
| Molecular Weight | 288.19 g/mol |
| Exact Mass | 287.05 |
| IUPAC Name | 2-[2-(2-bromo-4,6-dimethylphenoxy)ethylamino]ethanol |
| SMILES | Cc1cc(C)c(OCCNCCO)c(Br)c1 |
| InChI | InChI=1S/C12H18BrNO2/c1-9-7-10(2)12(11(13)8-9)16-6-4-14-3-5-15/h7-8,14-15H,3-6H2,1-2H3 |
| InChIKey | QOZNOKFOOZYLQT-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.19 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|