About 3-(2-bromo-4,6-dimethylphenoxy)propyl-[(2R)-butan-2-yl]azanium
3-(2-bromo-4,6-dimethylphenoxy)propyl-[(2R)-butan-2-yl]azanium (PubChem CID 2181906) has the molecular formula C15H25BrNO+
and a molecular weight of 315.27 g/mol. Its IUPAC name is 3-(2-bromo-4,6-dimethylphenoxy)propyl-[(2R)-butan-2-yl]azanium.
Molecular Properties
| Compound Name | 3-(2-bromo-4,6-dimethylphenoxy)propyl-[(2R)-butan-2-yl]azanium |
| PubChem CID | 2181906 |
| Molecular Formula | C15H25BrNO+ |
| Molecular Weight | 315.27 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | 3-(2-bromo-4,6-dimethylphenoxy)propyl-[(2R)-butan-2-yl]azanium |
| SMILES | CC[C@@H](C)[NH2+]CCCOc1c(C)cc(C)cc1Br |
| InChI | InChI=1S/C15H24BrNO/c1-5-13(4)17-7-6-8-18-15-12(3)9-11(2)10-14(15)16/h9-10,13,17H,5-8H2,1-4H3/p+1/t13-/m1/s1 |
| InChIKey | VGOLDQYBUVZFOS-CYBMUJFWSA-O |
| XLogP | 3.20 |
| TPSA | 25.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.27 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-bromo-4,6-dimethylphenoxy)propyl-[(2R)-butan-2-yl]azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-bromo-4,6-dimethylphenoxy)propyl-[(2R)-butan-2-yl]azanium?
The IUPAC name of 3-(2-bromo-4,6-dimethylphenoxy)propyl-[(2R)-butan-2-yl]azanium (CID 2181906) is 3-(2-bromo-4,6-dimethylphenoxy)propyl-[(2R)-butan-2-yl]azanium.
What is the SMILES notation for 3-(2-bromo-4,6-dimethylphenoxy)propyl-[(2R)-butan-2-yl]azanium?
The canonical SMILES for 3-(2-bromo-4,6-dimethylphenoxy)propyl-[(2R)-butan-2-yl]azanium is CC[C@@H](C)[NH2+]CCCOc1c(C)cc(C)cc1Br.
What is the InChIKey of 3-(2-bromo-4,6-dimethylphenoxy)propyl-[(2R)-butan-2-yl]azanium?
The InChIKey is VGOLDQYBUVZFOS-CYBMUJFWSA-O. The full InChI is InChI=1S/C15H24BrNO/c1-5-13(4)17-7-6-8-18-15-12(3)9-11(2)10-14(15)16/h9-10,13,17H,5-8H2,1-4H3/p+1/t13-/m1/s1.
What are the key properties of 3-(2-bromo-4,6-dimethylphenoxy)propyl-[(2R)-butan-2-yl]azanium?
3-(2-bromo-4,6-dimethylphenoxy)propyl-[(2R)-butan-2-yl]azanium has a molecular weight of 315.27 g/mol, XLogP of 3.20, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-bromo-4,6-dimethylphenoxy)propyl-[(2R)-butan-2-yl]azanium is sourced from PubChem (CID 2181906), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).