C15H25BrNO+ — CID 2181906
3-(2-bromo-4,6-dimethylphenoxy)propyl-[(2R)-butan-2-yl]azanium (PubChem CID 2181906) has the molecular formula C15H25BrNO+ and a molecular weight of 315.27 g/mol. Its IUPAC name is 3-(2-bromo-4,6-dimethylphenoxy)propyl-[(2R)-butan-2-yl]azanium.
| Compound Name | 3-(2-bromo-4,6-dimethylphenoxy)propyl-[(2R)-butan-2-yl]azanium |
|---|---|
| PubChem CID | 2181906 |
| Molecular Formula | C15H25BrNO+ |
| Molecular Weight | 315.27 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | 3-(2-bromo-4,6-dimethylphenoxy)propyl-[(2R)-butan-2-yl]azanium |
| SMILES | CC[C@@H](C)[NH2+]CCCOc1c(C)cc(C)cc1Br |
| InChI | InChI=1S/C15H24BrNO/c1-5-13(4)17-7-6-8-18-15-12(3)9-11(2)10-14(15)16/h9-10,13,17H,5-8H2,1-4H3/p+1/t13-/m1/s1 |
| InChIKey | VGOLDQYBUVZFOS-CYBMUJFWSA-O |
| XLogP | 3.20 |
| TPSA | 25.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.27 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|