C14H10Cl2N2O5 — CID 2188701
(3aS,7aR)-5-chloro-2-(3-chloro-2-hydroxy-5-nitrophenyl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione (PubChem CID 2188701) has the molecular formula C14H10Cl2N2O5 and a molecular weight of 357.15 g/mol. Its IUPAC name is (3aS,7aR)-5-chloro-2-(3-chloro-2-hydroxy-5-nitrophenyl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | (3aS,7aR)-5-chloro-2-(3-chloro-2-hydroxy-5-nitrophenyl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 2188701 |
| Molecular Formula | C14H10Cl2N2O5 |
| Molecular Weight | 357.15 g/mol |
| Exact Mass | 356.00 |
| IUPAC Name | (3aS,7aR)-5-chloro-2-(3-chloro-2-hydroxy-5-nitrophenyl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
| SMILES | O=C1[C@H]2CC(Cl)=CC[C@H]2C(=O)N1c1cc([N+](=O)[O-])cc(Cl)c1O |
| InChI | InChI=1S/C14H10Cl2N2O5/c15-6-1-2-8-9(3-6)14(21)17(13(8)20)11-5-7(18(22)23)4-10(16)12(11)19/h1,4-5,8-9,19H,2-3H2/t8-,9+/m1/s1 |
| InChIKey | DZTFGCJGJWKJHR-BDAKNGLRSA-N |
| XLogP | 2.98 |
| TPSA | 100.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.15 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|