C15H11ClNO4- — CID 6952927
3-[(3aS,7aR)-5-chloro-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]benzoate (PubChem CID 6952927) has the molecular formula C15H11ClNO4- and a molecular weight of 304.71 g/mol. Its IUPAC name is 3-[(3aS,7aR)-5-chloro-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]benzoate.
| Compound Name | 3-[(3aS,7aR)-5-chloro-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]benzoate |
|---|---|
| PubChem CID | 6952927 |
| Molecular Formula | C15H11ClNO4- |
| Molecular Weight | 304.71 g/mol |
| Exact Mass | 304.04 |
| IUPAC Name | 3-[(3aS,7aR)-5-chloro-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]benzoate |
| SMILES | O=C([O-])c1cccc(N2C(=O)[C@H]3CC(Cl)=CC[C@H]3C2=O)c1 |
| InChI | InChI=1S/C15H12ClNO4/c16-9-4-5-11-12(7-9)14(19)17(13(11)18)10-3-1-2-8(6-10)15(20)21/h1-4,6,11-12H,5,7H2,(H,20,21)/p-1/t11-,12+/m1/s1 |
| InChIKey | DVZAXOPJQHOGRB-NEPJUHHUSA-M |
| XLogP | 1.07 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.71 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|