C16H13ClNO4- — CID 7405644
5-[(3aS,7aR)-5-methyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-2-chlorobenzoate (PubChem CID 7405644) has the molecular formula C16H13ClNO4- and a molecular weight of 318.74 g/mol. Its IUPAC name is 5-[(3aS,7aR)-5-methyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-2-chlorobenzoate.
| Compound Name | 5-[(3aS,7aR)-5-methyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-2-chlorobenzoate |
|---|---|
| PubChem CID | 7405644 |
| Molecular Formula | C16H13ClNO4- |
| Molecular Weight | 318.74 g/mol |
| Exact Mass | 318.05 |
| IUPAC Name | 5-[(3aS,7aR)-5-methyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-2-chlorobenzoate |
| SMILES | CC1=CC[C@H]2C(=O)N(c3ccc(Cl)c(C(=O)[O-])c3)C(=O)[C@H]2C1 |
| InChI | InChI=1S/C16H14ClNO4/c1-8-2-4-10-11(6-8)15(20)18(14(10)19)9-3-5-13(17)12(7-9)16(21)22/h2-3,5,7,10-11H,4,6H2,1H3,(H,21,22)/p-1/t10-,11+/m1/s1 |
| InChIKey | COPLECYLFKVOII-MNOVXSKESA-M |
| XLogP | 1.55 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.74 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|