C17H13ClNO4- — CID 11880276
2-chloro-5-[(1R,2S,6R,7S)-3,5-dioxo-4-azatricyclo[5.2.2.02,6]undec-8-en-4-yl]benzoate (PubChem CID 11880276) has the molecular formula C17H13ClNO4- and a molecular weight of 330.75 g/mol. Its IUPAC name is 2-chloro-5-[(1R,2S,6R,7S)-3,5-dioxo-4-azatricyclo[5.2.2.02,6]undec-8-en-4-yl]benzoate.
| Compound Name | 2-chloro-5-[(1R,2S,6R,7S)-3,5-dioxo-4-azatricyclo[5.2.2.02,6]undec-8-en-4-yl]benzoate |
|---|---|
| PubChem CID | 11880276 |
| Molecular Formula | C17H13ClNO4- |
| Molecular Weight | 330.75 g/mol |
| Exact Mass | 330.05 |
| IUPAC Name | 2-chloro-5-[(1R,2S,6R,7S)-3,5-dioxo-4-azatricyclo[5.2.2.02,6]undec-8-en-4-yl]benzoate |
| SMILES | O=C([O-])c1cc(N2C(=O)[C@@H]3[C@H](C2=O)[C@@H]2C=C[C@H]3CC2)ccc1Cl |
| InChI | InChI=1S/C17H14ClNO4/c18-12-6-5-10(7-11(12)17(22)23)19-15(20)13-8-1-2-9(4-3-8)14(13)16(19)21/h1-2,5-9,13-14H,3-4H2,(H,22,23)/p-1/t8-,9+,13-,14+ |
| InChIKey | IYDXRYYGRNQATP-OGXIQJDLSA-M |
| XLogP | 1.41 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.75 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|