C22H25BrN2O3S — CID 2190746
2-[(3-bromophenyl)methylsulfanyl]-3-(3,3-diethoxypropyl)quinazolin-4-one (PubChem CID 2190746) has the molecular formula C22H25BrN2O3S and a molecular weight of 477.42 g/mol. Its IUPAC name is 2-[(3-bromophenyl)methylsulfanyl]-3-(3,3-diethoxypropyl)quinazolin-4-one.
| Compound Name | 2-[(3-bromophenyl)methylsulfanyl]-3-(3,3-diethoxypropyl)quinazolin-4-one |
|---|---|
| PubChem CID | 2190746 |
| Molecular Formula | C22H25BrN2O3S |
| Molecular Weight | 477.42 g/mol |
| Exact Mass | 476.08 |
| IUPAC Name | 2-[(3-bromophenyl)methylsulfanyl]-3-(3,3-diethoxypropyl)quinazolin-4-one |
| SMILES | CCOC(CCn1c(SCc2cccc(Br)c2)nc2ccccc2c1=O)OCC |
| InChI | InChI=1S/C22H25BrN2O3S/c1-3-27-20(28-4-2)12-13-25-21(26)18-10-5-6-11-19(18)24-22(25)29-15-16-8-7-9-17(23)14-16/h5-11,14,20H,3-4,12-13,15H2,1-2H3 |
| InChIKey | NWUNBYPVZPOGOC-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.42 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|