C18H27N3O2S — CID 2193150
ethyl 4-[(4-butylphenyl)carbamothioyl]piperazine-1-carboxylate (PubChem CID 2193150) has the molecular formula C18H27N3O2S and a molecular weight of 349.50 g/mol. Its IUPAC name is ethyl 4-[(4-butylphenyl)carbamothioyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[(4-butylphenyl)carbamothioyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 2193150 |
| Molecular Formula | C18H27N3O2S |
| Molecular Weight | 349.50 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | ethyl 4-[(4-butylphenyl)carbamothioyl]piperazine-1-carboxylate |
| SMILES | CCCCc1ccc(NC(=S)N2CCN(C(=O)OCC)CC2)cc1 |
| InChI | InChI=1S/C18H27N3O2S/c1-3-5-6-15-7-9-16(10-8-15)19-17(24)20-11-13-21(14-12-20)18(22)23-4-2/h7-10H,3-6,11-14H2,1-2H3,(H,19,24) |
| InChIKey | AIXLBYYCNAGIEU-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.50 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|