C16H22N2O2S — CID 859070
ethyl 1-[(4-methylphenyl)carbamothioyl]piperidine-4-carboxylate (PubChem CID 859070) has the molecular formula C16H22N2O2S and a molecular weight of 306.43 g/mol. Its IUPAC name is ethyl 1-[(4-methylphenyl)carbamothioyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[(4-methylphenyl)carbamothioyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 859070 |
| Molecular Formula | C16H22N2O2S |
| Molecular Weight | 306.43 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | ethyl 1-[(4-methylphenyl)carbamothioyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C(=S)Nc2ccc(C)cc2)CC1 |
| InChI | InChI=1S/C16H22N2O2S/c1-3-20-15(19)13-8-10-18(11-9-13)16(21)17-14-6-4-12(2)5-7-14/h4-7,13H,3,8-11H2,1-2H3,(H,17,21) |
| InChIKey | KAGQWAFJSKQEIZ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.43 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|