C15H21N3O2S — CID 2196017
methyl 2-[4-[(4-methylpiperazine-1-carbothioyl)amino]phenyl]acetate (PubChem CID 2196017) has the molecular formula C15H21N3O2S and a molecular weight of 307.42 g/mol. Its IUPAC name is methyl 2-[4-[(4-methylpiperazine-1-carbothioyl)amino]phenyl]acetate.
| Compound Name | methyl 2-[4-[(4-methylpiperazine-1-carbothioyl)amino]phenyl]acetate |
|---|---|
| PubChem CID | 2196017 |
| Molecular Formula | C15H21N3O2S |
| Molecular Weight | 307.42 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | methyl 2-[4-[(4-methylpiperazine-1-carbothioyl)amino]phenyl]acetate |
| SMILES | COC(=O)Cc1ccc(NC(=S)N2CCN(C)CC2)cc1 |
| InChI | InChI=1S/C15H21N3O2S/c1-17-7-9-18(10-8-17)15(21)16-13-5-3-12(4-6-13)11-14(19)20-2/h3-6H,7-11H2,1-2H3,(H,16,21) |
| InChIKey | YPIIMWUROQUFST-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.42 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|