C24H21N3O5 — CID 2196990
N-[4-[[(1R)-3,4-dihydro-1H-isochromen-1-yl]methylcarbamoyl]phenyl]-2-nitrobenzamide (PubChem CID 2196990) has the molecular formula C24H21N3O5 and a molecular weight of 431.45 g/mol. Its IUPAC name is N-[4-[[(1R)-3,4-dihydro-1H-isochromen-1-yl]methylcarbamoyl]phenyl]-2-nitrobenzamide.
| Compound Name | N-[4-[[(1R)-3,4-dihydro-1H-isochromen-1-yl]methylcarbamoyl]phenyl]-2-nitrobenzamide |
|---|---|
| PubChem CID | 2196990 |
| Molecular Formula | C24H21N3O5 |
| Molecular Weight | 431.45 g/mol |
| Exact Mass | 431.15 |
| IUPAC Name | N-[4-[[(1R)-3,4-dihydro-1H-isochromen-1-yl]methylcarbamoyl]phenyl]-2-nitrobenzamide |
| SMILES | O=C(NC[C@@H]1OCCc2ccccc21)c1ccc(NC(=O)c2ccccc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C24H21N3O5/c28-23(25-15-22-19-6-2-1-5-16(19)13-14-32-22)17-9-11-18(12-10-17)26-24(29)20-7-3-4-8-21(20)27(30)31/h1-12,22H,13-15H2,(H,25,28)(H,26,29)/t22-/m0/s1 |
| InChIKey | PLOSLTQEIKJCHD-QFIPXVFZSA-N |
| XLogP | 3.89 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.45 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|