C21H22N2O5 — CID 7470331
ethyl 4-[[2-[[(1S)-3,4-dihydro-1H-isochromen-1-yl]methylamino]-2-oxoacetyl]amino]benzoate (PubChem CID 7470331) has the molecular formula C21H22N2O5 and a molecular weight of 382.42 g/mol. Its IUPAC name is ethyl 4-[[2-[[(1S)-3,4-dihydro-1H-isochromen-1-yl]methylamino]-2-oxoacetyl]amino]benzoate.
| Compound Name | ethyl 4-[[2-[[(1S)-3,4-dihydro-1H-isochromen-1-yl]methylamino]-2-oxoacetyl]amino]benzoate |
|---|---|
| PubChem CID | 7470331 |
| Molecular Formula | C21H22N2O5 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | ethyl 4-[[2-[[(1S)-3,4-dihydro-1H-isochromen-1-yl]methylamino]-2-oxoacetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)C(=O)NC[C@H]2OCCc3ccccc32)cc1 |
| InChI | InChI=1S/C21H22N2O5/c1-2-27-21(26)15-7-9-16(10-8-15)23-20(25)19(24)22-13-18-17-6-4-3-5-14(17)11-12-28-18/h3-10,18H,2,11-13H2,1H3,(H,22,24)(H,23,25)/t18-/m1/s1 |
| InChIKey | UTHYTOQIADGNTK-GOSISDBHSA-N |
| XLogP | 2.23 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|