C18H30NO+ — CID 2199598
3-[2-[(2S)-butan-2-yl]phenoxy]propyl-cyclopentylazanium (PubChem CID 2199598) has the molecular formula C18H30NO+ and a molecular weight of 276.44 g/mol. Its IUPAC name is 3-[2-[(2S)-butan-2-yl]phenoxy]propyl-cyclopentylazanium.
| Compound Name | 3-[2-[(2S)-butan-2-yl]phenoxy]propyl-cyclopentylazanium |
|---|---|
| PubChem CID | 2199598 |
| Molecular Formula | C18H30NO+ |
| Molecular Weight | 276.44 g/mol |
| Exact Mass | 276.23 |
| IUPAC Name | 3-[2-[(2S)-butan-2-yl]phenoxy]propyl-cyclopentylazanium |
| SMILES | CC[C@H](C)c1ccccc1OCCC[NH2+]C1CCCC1 |
| InChI | InChI=1S/C18H29NO/c1-3-15(2)17-11-6-7-12-18(17)20-14-8-13-19-16-9-4-5-10-16/h6-7,11-12,15-16,19H,3-5,8-10,13-14H2,1-2H3/p+1/t15-/m0/s1 |
| InChIKey | AWILWAIEQYZUEQ-HNNXBMFYSA-O |
| XLogP | 3.47 |
| TPSA | 25.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.44 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|