C19H34N2O+2 — CID 2216199
1-[3-[2-[(2S)-butan-2-yl]phenoxy]propyl]-4-ethylpiperazine-1,4-diium (PubChem CID 2216199) has the molecular formula C19H34N2O+2 and a molecular weight of 306.49 g/mol. Its IUPAC name is 1-[3-[2-[(2S)-butan-2-yl]phenoxy]propyl]-4-ethylpiperazine-1,4-diium.
| Compound Name | 1-[3-[2-[(2S)-butan-2-yl]phenoxy]propyl]-4-ethylpiperazine-1,4-diium |
|---|---|
| PubChem CID | 2216199 |
| Molecular Formula | C19H34N2O+2 |
| Molecular Weight | 306.49 g/mol |
| Exact Mass | 306.27 |
| IUPAC Name | 1-[3-[2-[(2S)-butan-2-yl]phenoxy]propyl]-4-ethylpiperazine-1,4-diium |
| SMILES | CC[C@H](C)c1ccccc1OCCC[NH+]1CC[NH+](CC)CC1 |
| InChI | InChI=1S/C19H32N2O/c1-4-17(3)18-9-6-7-10-19(18)22-16-8-11-21-14-12-20(5-2)13-15-21/h6-7,9-10,17H,4-5,8,11-16H2,1-3H3/p+2/t17-/m0/s1 |
| InChIKey | WGLDNGJKCLVIFW-KRWDZBQOSA-P |
| XLogP | 0.77 |
| TPSA | 18.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.49 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|