C17H16ClN2O6S- — CID 2200833
4-[[[5-(2-amino-2-oxoethoxy)-2-chloro-4-methylphenyl]sulfonylamino]methyl]benzoate (PubChem CID 2200833) has the molecular formula C17H16ClN2O6S- and a molecular weight of 411.84 g/mol. Its IUPAC name is 4-[[[5-(2-amino-2-oxoethoxy)-2-chloro-4-methylphenyl]sulfonylamino]methyl]benzoate.
| Compound Name | 4-[[[5-(2-amino-2-oxoethoxy)-2-chloro-4-methylphenyl]sulfonylamino]methyl]benzoate |
|---|---|
| PubChem CID | 2200833 |
| Molecular Formula | C17H16ClN2O6S- |
| Molecular Weight | 411.84 g/mol |
| Exact Mass | 411.04 |
| IUPAC Name | 4-[[[5-(2-amino-2-oxoethoxy)-2-chloro-4-methylphenyl]sulfonylamino]methyl]benzoate |
| SMILES | Cc1cc(Cl)c(S(=O)(=O)NCc2ccc(C(=O)[O-])cc2)cc1OCC(N)=O |
| InChI | InChI=1S/C17H17ClN2O6S/c1-10-6-13(18)15(7-14(10)26-9-16(19)21)27(24,25)20-8-11-2-4-12(5-3-11)17(22)23/h2-7,20H,8-9H2,1H3,(H2,19,21)(H,22,23)/p-1 |
| InChIKey | ZATPPEBXJKUXCS-UHFFFAOYSA-M |
| XLogP | 0.35 |
| TPSA | 138.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.84 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |