C16H22N2O5S — CID 22008726
ethyl 2-(4-benzylsulfonyl-7-oxo-1,4-diazepan-1-yl)acetate (PubChem CID 22008726) has the molecular formula C16H22N2O5S and a molecular weight of 354.43 g/mol. Its IUPAC name is ethyl 2-(4-benzylsulfonyl-7-oxo-1,4-diazepan-1-yl)acetate.
| Compound Name | ethyl 2-(4-benzylsulfonyl-7-oxo-1,4-diazepan-1-yl)acetate |
|---|---|
| PubChem CID | 22008726 |
| Molecular Formula | C16H22N2O5S |
| Molecular Weight | 354.43 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | ethyl 2-(4-benzylsulfonyl-7-oxo-1,4-diazepan-1-yl)acetate |
| SMILES | CCOC(=O)CN1CCN(S(=O)(=O)Cc2ccccc2)CCC1=O |
| InChI | InChI=1S/C16H22N2O5S/c1-2-23-16(20)12-17-10-11-18(9-8-15(17)19)24(21,22)13-14-6-4-3-5-7-14/h3-7H,2,8-13H2,1H3 |
| InChIKey | OONCXNMGYAKHJK-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.43 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |