C15H20N2O3 — CID 22008730
ethyl 2-(7-oxo-4-phenyl-1,4-diazepan-1-yl)acetate (PubChem CID 22008730) has the molecular formula C15H20N2O3 and a molecular weight of 276.34 g/mol. Its IUPAC name is ethyl 2-(7-oxo-4-phenyl-1,4-diazepan-1-yl)acetate.
| Compound Name | ethyl 2-(7-oxo-4-phenyl-1,4-diazepan-1-yl)acetate |
|---|---|
| PubChem CID | 22008730 |
| Molecular Formula | C15H20N2O3 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | ethyl 2-(7-oxo-4-phenyl-1,4-diazepan-1-yl)acetate |
| SMILES | CCOC(=O)CN1CCN(c2ccccc2)CCC1=O |
| InChI | InChI=1S/C15H20N2O3/c1-2-20-15(19)12-17-11-10-16(9-8-14(17)18)13-6-4-3-5-7-13/h3-7H,2,8-12H2,1H3 |
| InChIKey | UIWYEIQHWABJEE-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |