About dioxido(oxo)silane;bis(ethyl-tris(3-hydroxypropyl)azanium)
dioxido(oxo)silane;bis(ethyl-tris(3-hydroxypropyl)azanium) (PubChem CID 22013492) has the molecular formula C22H52N2O9Si
and a molecular weight of 516.75 g/mol. Its IUPAC name is dioxido(oxo)silane;bis(ethyl-tris(3-hydroxypropyl)azanium).
Molecular Properties
| Compound Name | dioxido(oxo)silane;bis(ethyl-tris(3-hydroxypropyl)azanium) |
| PubChem CID | 22013492 |
| Molecular Formula | C22H52N2O9Si |
| Molecular Weight | 516.75 g/mol |
| Exact Mass | 516.34 |
| IUPAC Name | dioxido(oxo)silane;bis(ethyl-tris(3-hydroxypropyl)azanium) |
| SMILES | CC[N+](CCCO)(CCCO)CCCO.CC[N+](CCCO)(CCCO)CCCO.O=[Si]([O-])[O-] |
| InChI | InChI=1S/2C11H26NO3.O3Si/c2*1-2-12(6-3-9-13,7-4-10-14)8-5-11-15;1-4(2)3/h2*13-15H,2-11H2,1H3;/q2*+1;-2 |
| InChIKey | UGMGJELMUOPLKG-UHFFFAOYSA-N |
| XLogP | -2.94 |
| TPSA | 184.57 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 516.75 |
| LogP ≤ 5 | -2.94 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze dioxido(oxo)silane;bis(ethyl-tris(3-hydroxypropyl)azanium) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dioxido(oxo)silane;bis(ethyl-tris(3-hydroxypropyl)azanium)?
The IUPAC name of dioxido(oxo)silane;bis(ethyl-tris(3-hydroxypropyl)azanium) (CID 22013492) is dioxido(oxo)silane;bis(ethyl-tris(3-hydroxypropyl)azanium).
What is the SMILES notation for dioxido(oxo)silane;bis(ethyl-tris(3-hydroxypropyl)azanium)?
The canonical SMILES for dioxido(oxo)silane;bis(ethyl-tris(3-hydroxypropyl)azanium) is CC[N+](CCCO)(CCCO)CCCO.CC[N+](CCCO)(CCCO)CCCO.O=[Si]([O-])[O-].
What is the InChIKey of dioxido(oxo)silane;bis(ethyl-tris(3-hydroxypropyl)azanium)?
The InChIKey is UGMGJELMUOPLKG-UHFFFAOYSA-N. The full InChI is InChI=1S/2C11H26NO3.O3Si/c2*1-2-12(6-3-9-13,7-4-10-14)8-5-11-15;1-4(2)3/h2*13-15H,2-11H2,1H3;/q2*+1;-2.
What are the key properties of dioxido(oxo)silane;bis(ethyl-tris(3-hydroxypropyl)azanium)?
dioxido(oxo)silane;bis(ethyl-tris(3-hydroxypropyl)azanium) has a molecular weight of 516.75 g/mol, XLogP of -2.94, 20 rotatable bonds, 6 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for dioxido(oxo)silane;bis(ethyl-tris(3-hydroxypropyl)azanium) is sourced from PubChem (CID 22013492), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).